JNK3 inhibitor-1 structure
|
Common Name | JNK3 inhibitor-1 | ||
|---|---|---|---|---|
| CAS Number | 2622877-97-6 | Molecular Weight | 457.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17ClFN5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JNK3 inhibitor-1JNK3 inhibitor-1 is a potent and selective JNK3 inhibitor (IC50 = 0.005 μM). JNK3 inhibitor-1 is orally bioavailable and brain penetrant. |
| Name | JNK3 inhibitor-1 |
|---|
| Description | JNK3 inhibitor-1 is a potent and selective JNK3 inhibitor (IC50 = 0.005 μM). JNK3 inhibitor-1 is orally bioavailable and brain penetrant. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H17ClFN5O2S |
|---|---|
| Molecular Weight | 457.91 |
| InChIKey | KDMADGZAPDHVHE-UHFFFAOYSA-N |
| SMILES | Cc1nc2c(cnn2-c2csc(C(=O)NC3COC3)c2)cc1Nc1c(F)cccc1Cl |