RET-IN-8 structure
|
Common Name | RET-IN-8 | ||
|---|---|---|---|---|
| CAS Number | 2642164-75-6 | Molecular Weight | 486.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H30N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RET-IN-8RET-IN-8 is a rearranged during transfection (RET) kinase inhibitor extracted from patent WO2021093720A1 compound I-1. RET-IN-8 can be used for the research of cancer[1]. |
| Name | RET-IN-8 |
|---|
| Description | RET-IN-8 is a rearranged during transfection (RET) kinase inhibitor extracted from patent WO2021093720A1 compound I-1. RET-IN-8 can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H30N6O3 |
|---|---|
| Molecular Weight | 486.57 |
| InChIKey | CCOLQMCRERFSQU-AREMUKBSSA-N |
| SMILES | CC(C)C(O)C(=O)N1CCN(c2ccc(-c3cc(C4=CCOCC4)cn4ncc(C#N)c34)cn2)CC1 |