MODAG-001 structure
|
Common Name | MODAG-001 | ||
|---|---|---|---|---|
| CAS Number | 2648041-72-7 | Molecular Weight | 343.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15BrN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MODAG-001MODAG-001 can bind to synuclein fibrils in a rat brain. MODAG-001 is a candidate α-syn imaging probe[1][2][3]. |
| Name | MODAG-001 |
|---|
| Description | MODAG-001 can bind to synuclein fibrils in a rat brain. MODAG-001 is a candidate α-syn imaging probe[1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | MODAG-001 shows strong binding affinity to recombinant human α-syn aggregates, but fail to bind real α-syn aggregates in human brain sections[2]. |
| References |
| Molecular Formula | C16H15BrN4 |
|---|---|
| Molecular Weight | 343.22 |
| InChIKey | KHJCRNBFTHZLAE-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccnc(Br)c3)n[nH]2)cc1 |