ANEB-001 structure
|
Common Name | ANEB-001 | ||
|---|---|---|---|---|
| CAS Number | 791848-71-0 | Molecular Weight | 440.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ANEB-001ANEB-001 is an orally active CB1 inhibitor, can be used to research acute cannabinoid intoxication[1]. |
| Name | ANEB-001 |
|---|
| Description | ANEB-001 is an orally active CB1 inhibitor, can be used to research acute cannabinoid intoxication[1]. |
|---|---|
| Related Catalog | |
| Target |
CB1 |
| References |
| Molecular Formula | C22H24ClF3N2O2 |
|---|---|
| Molecular Weight | 440.89 |
| InChIKey | BNLYOVHLLDBOFZ-LJQANCHMSA-N |
| SMILES | CC(C)(C)NC(=O)N1CC(OC(c2ccc(Cl)cc2)c2ccccc2C(F)(F)F)C1 |