PROTAC IRAK3 degrade-1
Modify Date: 2025-08-26 22:59:57
PROTAC IRAK3 degrade-1 structure
|
Common Name | PROTAC IRAK3 degrade-1 | ||
|---|---|---|---|---|
| CAS Number | 2712600-00-3 | Molecular Weight | 878.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H63N11O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PROTAC IRAK3 degrade-1PROTAC IRAK3 degrade-1 is a potent and selective degrader of IRAK3 (IC50 = 5 nM). |
| Name | PROTAC IRAK3 degrade-1 |
|---|
| Description | PROTAC IRAK3 degrade-1 is a potent and selective degrader of IRAK3 (IC50 = 5 nM). |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C47H63N11O6 |
|---|---|
| Molecular Weight | 878.07 |
| InChIKey | ZUODKONSNNHSAJ-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccn2ncnc(NC3CCC(N4CCN(C(=O)CCC(=O)N5CCC(CCN6CCN(c7ccc8c(c7)C(=O)N(C7CCC(=O)NC7=O)C8=O)CC6)CC5)CC4)CC3)c12 |