GLP1-agonist-2 structure
|
Common Name | GLP1-agonist-2 | ||
|---|---|---|---|---|
| CAS Number | 281209-71-0 | Molecular Weight | 348.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15Cl2N3O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of GLP1-agonist-2GLP-1R agonist 2 (compound 2) is a potent GLP-1R agonist. GLP-1R agonist 2 has the potential for the research of metabolic diseases like Type2 Diabetes and Obesity[1]. |
| Name | 6,7-Dichloro-N-(2-methyl-2-propanyl)-3-(methylsulfonyl)-2-quinoxa linamine |
|---|
| Description | GLP-1R agonist 2 (compound 2) is a potent GLP-1R agonist. GLP-1R agonist 2 has the potential for the research of metabolic diseases like Type2 Diabetes and Obesity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H15Cl2N3O2S |
|---|---|
| Molecular Weight | 348.24800 |
| Exact Mass | 347.02600 |
| PSA | 83.56000 |
| LogP | 4.05320 |
| InChIKey | GNZCSGYHILBXLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Nc1nc2cc(Cl)c(Cl)cc2nc1S(C)(=O)=O |
| Storage condition | 2-8°C |