Taurohyodeoxycholic Acid structure
|
Common Name | Taurohyodeoxycholic Acid | ||
|---|---|---|---|---|
| CAS Number | 2958-04-5 | Molecular Weight | 499.70400 | |
| Density | 1.216g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H45NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Taurohyodeoxycholic AcidTaurohyodeoxycholic acid is the tauroconjugated form of Hyodeoxycholic acid (HDCA, a dihydroxylated natural bile acid). Taurohyodeoxycholic acid induces a biliary phospholipid secretion and suggests a hepatoprotective potential. Taurohyodeoxycholic acid also can promote gallstone dissolution[1][1]. |
| Name | Taurohyodeoxycholic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | Taurohyodeoxycholic acid is the tauroconjugated form of Hyodeoxycholic acid (HDCA, a dihydroxylated natural bile acid). Taurohyodeoxycholic acid induces a biliary phospholipid secretion and suggests a hepatoprotective potential. Taurohyodeoxycholic acid also can promote gallstone dissolution[1][1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.216g/cm3 |
|---|---|
| Molecular Formula | C26H45NO6S |
| Molecular Weight | 499.70400 |
| Exact Mass | 499.29700 |
| PSA | 132.31000 |
| LogP | 4.86900 |
| Index of Refraction | 1.552 |
| InChIKey | HMXPOCDLAFAFNT-BHYUGXBJSA-N |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C3CC(O)C4CC(O)CCC4(C)C3CCC12C |
| Taurohyodesoxycholsaeure |
| tatsinine perchlorate |