HIF-2α-IN-3 structure
|
Common Name | HIF-2α-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 313964-19-1 | Molecular Weight | 335.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6ClN5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HIF-2α-IN-3HIF-2α-IN-3, an allosteric inhibitor of hypoxia inducible factor-2α (HIF-2α), exhibits an IC50 of 0.4 µM and a KD of 1.1 µM. Anticancer agent[1]. |
| Name | HIF-2α-IN-3 |
|---|
| Description | HIF-2α-IN-3, an allosteric inhibitor of hypoxia inducible factor-2α (HIF-2α), exhibits an IC50 of 0.4 µM and a KD of 1.1 µM. Anticancer agent[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.4 µM (HIF-2α)[1] KD: 1.1 µM (HIF-2α)[1] |
| In Vitro | HIF-2α-IN-3 (Compound 1) inhibit HIF-2α-ARNT (also known as HIF-β) heterodimerization by binding an internal cavity of the HIF-2α PAS-B domain[1]. |
| References |
| Molecular Formula | C12H6ClN5O5 |
|---|---|
| Molecular Weight | 335.66 |
| InChIKey | PQZKMXPISWCLCU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Nc2ccc3nonc3c2[N+](=O)[O-])ccc1Cl |
| Storage condition | 2-8°C |