Disodium 2'-deoxy-5'-O-phosphonatoguanosine structure
|
Common Name | Disodium 2'-deoxy-5'-O-phosphonatoguanosine | ||
|---|---|---|---|---|
| CAS Number | 33430-61-4 | Molecular Weight | 391.185 | |
| Density | 2.32g/cm3 | Boiling Point | 844.2ºC at 760mmHg | |
| Molecular Formula | C10H12N5Na2O7P | Melting Point | >245°C (dec.) | |
| MSDS | N/A | Flash Point | 464.4ºC | |
Use of Disodium 2'-deoxy-5'-O-phosphonatoguanosine2'-Deoxyguanosine 5'-monophosphate disodium (5′-dGMP disodium) is a mononucleotide having guanine as the nucleobase. 2'-Deoxyguanosine 5'-monophosphate disodium is a nucleic acid guanosine triphosphate (GTP) derivative[1]. |
| Name | 2'-Deoxyguanosine-5'-monophosphate disodium salt hydrate |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Deoxyguanosine 5'-monophosphate disodium (5′-dGMP disodium) is a mononucleotide having guanine as the nucleobase. 2'-Deoxyguanosine 5'-monophosphate disodium is a nucleic acid guanosine triphosphate (GTP) derivative[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.32g/cm3 |
|---|---|
| Boiling Point | 844.2ºC at 760mmHg |
| Melting Point | >245°C (dec.) |
| Molecular Formula | C10H12N5Na2O7P |
| Molecular Weight | 391.185 |
| Flash Point | 464.4ºC |
| Exact Mass | 391.026978 |
| PSA | 201.28000 |
| InChIKey | CTPAMSRBXKGZCJ-PCFPTEBNSA-L |
| SMILES | Nc1nc2c(ncn2C2CC(O)C(COP(=O)([O-])[O-])O2)c(=O)[nH]1.[Na+].[Na+] |
| Storage condition | Store at 0°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| MFCD00080331 |
| disodium,[5-(2-amino-6-oxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl phosphate |
| 2'-Deoxyguanosine-5'-monophosphoric acid disodium salt |
| Disodium 2'-deoxy-5'-O-phosphonatoguanosine |
| 5'-Guanylic acid, 2'-deoxy-, sodium salt (1:2) |
| EINECS 251-517-5 |