3 3' 5-triiodo-l-thyronine sodium salt& structure
|
Common Name | 3 3' 5-triiodo-l-thyronine sodium salt& | ||
|---|---|---|---|---|
| CAS Number | 345957-19-9 | Molecular Weight | 690.97100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13I3NNaO5 | Melting Point | 205ºC (dec.)(lit.) | |
| MSDS | USA | Flash Point | N/A | |
Use of 3 3' 5-triiodo-l-thyronine sodium salt&Liothyronine sodium hydrate is an active form of thyroid hormone. Liothyronine sodium hydrate is a potent thyroid hormone receptors TRα and TRβ agonist with Kis of 2.33 nM for hTRα and hTRβ, respectively[1][2][3]. |
| Name | Sodium (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophen yl]propanoate hydrate (1:1:1) |
|---|
| Description | Liothyronine sodium hydrate is an active form of thyroid hormone. Liothyronine sodium hydrate is a potent thyroid hormone receptors TRα and TRβ agonist with Kis of 2.33 nM for hTRα and hTRβ, respectively[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Liothyronine (T3, 100 nM) sodium hydrate stimulates the proliferation of hepatocarcinema cells in which TRβ1 is overexpressed[1]. Liothyronine sodium hydrate binds to human β1 thyroid hormone receptor (hTRβ1), and changes its conformation. Liothyronine sodium hydrate promotes growth, induces differentiation and regualtes metabolic effects[2]. |
| References |
| Melting Point | 205ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C15H13I3NNaO5 |
| Molecular Weight | 690.97100 |
| Exact Mass | 690.78300 |
| PSA | 104.84000 |
| LogP | 5.02690 |
| InChIKey | IRGJMZGKFAPCCR-LTCKWSDVSA-M |
| SMILES | NC(Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)[O-].O.[Na+] |
| Storage condition | -20°C |
| Safety Phrases | S22-S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |