SB-423557 structure
|
Common Name | SB-423557 | ||
|---|---|---|---|---|
| CAS Number | 351490-26-1 | Molecular Weight | 464.59600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H36N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SB-423557SB-423557 is an orally active calcium-sensing receptor (CaR) antagonist (IC50=520 nM), precursor of SB-423562 (IC50=73 nM). SB-423557 is well tolerated in human and increases plasma concentrations of exogenous parathyroid hormone (PTH) and stimulates bone formation[1]. |
| Name | sb-423557 |
|---|
| Description | SB-423557 is an orally active calcium-sensing receptor (CaR) antagonist (IC50=520 nM), precursor of SB-423562 (IC50=73 nM). SB-423557 is well tolerated in human and increases plasma concentrations of exogenous parathyroid hormone (PTH) and stimulates bone formation[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 520 nM (Calcium-sensing receptor)[1] |
| In Vivo | SB-423557 (oral administration; 10, 30 or 100 μM/kg; once daily; 12 weeks) elicits transient increases in plasma concentrations of PTH, resulting in increased bone mass and strength in both vertebrae and long bones compared to that of OVX controls[1]. |
| References |
| Molecular Formula | C28H36N2O4 |
|---|---|
| Molecular Weight | 464.59600 |
| Exact Mass | 464.26800 |
| PSA | 91.58000 |
| LogP | 4.35788 |
| InChIKey | DMWBVRRUBDZTBK-RUZDIDTESA-N |
| SMILES | CCOC(=O)CCc1ccc(C#N)c(OCC(O)CNC(C)(C)CC2Cc3ccccc3C2)c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |