N-Cbz-L-Glutamic acid 5-tert-butyl ester structure
|
Common Name | N-Cbz-L-Glutamic acid 5-tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 3886-08-6 | Molecular Weight | 337.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 522.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO6 | Melting Point | 83-87ºC | |
| MSDS | Chinese USA | Flash Point | 269.9±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-Cbz-L-Glutamic acid 5-tert-butyl esterZ-Glu(OtBu)-OH is a derivative of glutamate, can be used for molecule, drug, compounds synthesis[1]. |
| Name | Z-Glu(OtBu)-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Glu(OtBu)-OH is a derivative of glutamate, can be used for molecule, drug, compounds synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Shaomeng Wang, et al. Small molecule stat protein degraders. WO2021195481A1 (compound A) |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.6±50.0 °C at 760 mmHg |
| Melting Point | 83-87ºC |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.368 |
| Flash Point | 269.9±30.1 °C |
| Exact Mass | 337.152527 |
| PSA | 101.93000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | GLMODRZPPBZPPB-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-tert-butoxy-5-oxopentanoic acid (non-preferred name) |
| 5-tert-butyl ester |
| MFCD00038274 |
| EINECS 223-421-3 |
| N-Carbobenzoxy-L-glutamic Acid 5-tert-Butyl Ester |
| (S)-2-(((Benzyloxy)carbonyl)amino)-5-(tert-butoxy)-5-oxopentanoic acid |
| N-Benzyloxycarbonyl-L-glutamic acid gamma-tert-butyl ester |
| N-Cbz-L-Glutamic acid 5-tert-butyl ester |
| 5-tert-Butyl N-Cbz-L-glutamate |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoate |
| Cbz-L-glutamic acid 5-tert-butyl ester |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-tert-butoxy-5-oxopentanoate |
| 5-tert-Butyl N-Carbobenzoxy-L-glutamate |
| 5-tert-Butyl N-((phenylmethoxy)carbonyl)-L-glutamate |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 5-(1,1-dimethylethyl) ester, ion(1-) |
| (2S)-2-{[(Benzyloxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| L-Glutamic acid, N-[(phenylmethoxy)carbonyl]-, 5-(1,1-dimethylethyl) ester |