Benzoyl chloride,4-(acetyloxy)-3,5-dimethoxy- structure
|
Common Name | Benzoyl chloride,4-(acetyloxy)-3,5-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 39657-47-1 | Molecular Weight | 258.65500 | |
| Density | 1.283g/cm3 | Boiling Point | 323.7ºC at 760mmHg | |
| Molecular Formula | C11H11ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.7ºC | |
| Name | (4-carbonochloridoyl-2,6-dimethoxyphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 323.7ºC at 760mmHg |
| Molecular Formula | C11H11ClO5 |
| Molecular Weight | 258.65500 |
| Flash Point | 128.7ºC |
| Exact Mass | 258.03000 |
| PSA | 61.83000 |
| LogP | 2.00810 |
| Index of Refraction | 1.519 |
| InChIKey | GUYBWIMXUDUWPX-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Cl)cc(OC)c1OC(C)=O |
| HS Code | 2916399090 |
|---|
|
~87%
Benzoyl chlorid... CAS#:39657-47-1 |
| Literature: Yeun, Go Heum; Lee, Seung Hwan; Lim, Yong Bae; Lee, Hye Sook; Won, Moo-Ho; Lee, Bong Ho; Park, Jeong Ho Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 4 p. 1025 - 1029 |
|
~%
Benzoyl chlorid... CAS#:39657-47-1 |
| Literature: Gita, Haruhisa; Sobe, Yoshiaki; Akaku, Haruo; Ekine, Rena; Oto, Yuso; Isawa, Satoru; Hayashi, Hideya Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 4 p. 549 - 551 |
|
~%
Benzoyl chlorid... CAS#:39657-47-1 |
| Literature: Bradley; Robinson Journal of the Chemical Society, 1928 , p. 1551 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| O-acetylsyringoyl chloride |
| 4-Acetoxy-3,5-dimethoxybenzoyl chloride |
| O-acetylsyringic acid chloride |
| 3,5-dimethoxy-4-acetoxybenzoyl chloride |
| acetyl syringic acid chloride |
| EINECS 254-567-6 |