ACTH (4-10) structure
|
Common Name | ACTH (4-10) | ||
|---|---|---|---|---|
| CAS Number | 4037-01-8 | Molecular Weight | 962.09 | |
| Density | 1.48g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H59N13O10S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of ACTH (4-10)Adrenocorticotropic Hormone (ACTH) (4-10), human is a melanocortin 4 (MC4R) receptor agonist. |
| Name | met-glu-his-phe-arg-trp-gly |
|---|---|
| Synonym | More Synonyms |
| Description | Adrenocorticotropic Hormone (ACTH) (4-10), human is a melanocortin 4 (MC4R) receptor agonist. |
|---|---|
| Related Catalog | |
| Target |
Melanocortin 4 receptor[1] |
| In Vitro | Adrenocorticotropic Hormone (ACTH) (4-10), human (ACTH (4-10)) is the core sequence of all melanocortins and binds selectively to MC4-R. In humans, ACTH (4-10) enters the cerebral fluid compartment after intranasal application and leads to a decrease in total body fat after 6 weeks of continuous treatment[1]. |
| References |
| Density | 1.48g/cm3 |
|---|---|
| Molecular Formula | C44H59N13O10S |
| Molecular Weight | 962.09 |
| PSA | 183.70000 |
| LogP | 9.43540 |
| Vapour Pressure | 4.64E-09mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | ICCLJCOVWYXLTE-CZPFDPCBSA-N |
| SMILES | CSCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O.O=C(O)C(F)(F)F |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Ligand-dependent activation of the melanocortin 5 receptor: cAMP production and ryanodine receptor-dependent elevations of [Ca(2+)](I).
Biochem. Biophys. Res. Commun. 290 , 844-850, (2002) The melanocortins are involved in the regulation of various cognitive and physiological processes such as learning, feeding, immune suppression, pigmentation, and sebum production. Five melanocortin r... |
|
|
Sniffing neuropeptides: a transnasal approach to the human brain.
Nat. Neurosci. 5(6) , 514-6, (2002)
|
|
|
The melanocortin melanocyte-stimulating hormone/adrenocorticotropin(4-10) decreases body fat in humans.
J. Clin. Endocrinol. Metab. 86(3) , 1144-8, (2001) The control of body fat is a prominent factor in human health. Animal studies have indicated a homeostatic central nervous system regulation of body fat with particular involvement of the melanocortin... |
| Adrenalonium chloratum |
| adrenalon hydrochloride |
| Adrenone hydrochloride |
| ADRENALONE,HYDROCHLORIDE |
| Stryphnonasal |
| Kephrine hydrochloride |
| Epinephrine ketone hydrochloride |
| ADRENALONE HCL |
| Adrenocorticotropic Hormone (ACTH) (4-10), human |