KT 1 structure
|
Common Name | KT 1 | ||
|---|---|---|---|---|
| CAS Number | 47487-05-8 | Molecular Weight | 366.36900 | |
| Density | 1.278g/cm3 | Boiling Point | 536.8ºC at 760mmHg | |
| Molecular Formula | C16H22N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.4ºC | |
Use of KT 1KT 1 decreased aortic pressure, renal blood flow, left ventricular enddiastolic pressure and resistances of total peripheral, vertebral, coronary and renal vasculatures and increased aortic blood flow, vertebral blood flow, coronary blood flow, peak positive left ventricular dP/dt and heart rate in anesthetized open-chest dogs. |
| Name | 5-[(6,7,8-trimethoxyquinazolin-4-yl)amino]pentyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 536.8ºC at 760mmHg |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.36900 |
| Flash Point | 278.4ºC |
| Exact Mass | 366.15400 |
| PSA | 123.78000 |
| LogP | 2.39120 |
| Index of Refraction | 1.586 |
| InChIKey | XEMQGFBCRICHHG-UHFFFAOYSA-N |
| SMILES | COc1cc2c(NCCCCCO[N+](=O)[O-])ncnc2c(OC)c1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| kt 1 |