5-(3-trifluoromethyl-phenyl)-furan-2-carbaldehyde structure
|
Common Name | 5-(3-trifluoromethyl-phenyl)-furan-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 52130-30-0 | Molecular Weight | 240.17800 | |
| Density | 1.314g/cm3 | Boiling Point | 326.2ºC at 760 mmHg | |
| Molecular Formula | C12H7F3O2 | Melting Point | 64-66 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 151.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-[3-(trifluoromethyl)phenyl]furan-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 326.2ºC at 760 mmHg |
| Melting Point | 64-66 °C(lit.) |
| Molecular Formula | C12H7F3O2 |
| Molecular Weight | 240.17800 |
| Flash Point | 151.1ºC |
| Exact Mass | 240.04000 |
| PSA | 30.21000 |
| LogP | 3.77790 |
| Index of Refraction | 1.512 |
| InChIKey | MRVWKXZQBOFMAW-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2cccc(C(F)(F)F)c2)o1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932190090 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-[3-(trifluoromethyl)phenyl]furfural |
| 5-(3-trifluoromethylphenyl)furan-2-carbaldehyde |
| 5-[3-(trifluoromethyl)phenyl]-2-furancarboxaldehyde |
| 2-formyl-5-[3-(trifluoromethyl)phenyl]furan |
| MFCD00274241 |
| 5-(3-trifluoromethylphenyl)-2-furaldehyde |