9(Z),11(E),13(Z)-Octadecatrienoic Acid structure
|
Common Name | 9(Z),11(E),13(Z)-Octadecatrienoic Acid | ||
|---|---|---|---|---|
| CAS Number | 544-72-9 | Molecular Weight | 278.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 9(Z),11(E),13(Z)-Octadecatrienoic AcidPunicic acid is a bioactive compound of pomegranate seed oil. Punicic acid is an isomer of conjugated α-linolenic acid and a ω-5 polyunsaturated fatty acid. Punicic acid has the potential for the research of various chronic diseases[1]. |
| Name | punicic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Punicic acid is a bioactive compound of pomegranate seed oil. Punicic acid is an isomer of conjugated α-linolenic acid and a ω-5 polyunsaturated fatty acid. Punicic acid has the potential for the research of various chronic diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H30O2 |
|---|---|
| Molecular Weight | 278.43000 |
| Exact Mass | 278.22500 |
| PSA | 37.30000 |
| LogP | 5.66050 |
| InChIKey | CUXYLFPMQMFGPL-BGDVVUGTSA-N |
| SMILES | CCCCC=CC=CC=CCCCCCCCC(=O)O |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 9-cis,11-trans,13-cis-octadecatrienoic acid |
| Trichosanoic acid |
| Punicic acid |
| (9Z,11E,13Z)-octadeca-9,11,13-trienoic acid |
| Trichosanic acid |
| cis-9,trans-11,cis-13-Octadecatrienoic acid |