Decanoic acid,1,4,7-heptanetriyl ester (9CI) structure
|
Common Name | Decanoic acid,1,4,7-heptanetriyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5453-35-0 | Molecular Weight | 610.94800 | |
| Density | 0.939g/cm3 | Boiling Point | 644.6ºC at 760mmHg | |
| Molecular Formula | C37H70O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.6ºC | |
| Name | 4,7-di(decanoyloxy)heptyl decanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 644.6ºC at 760mmHg |
| Molecular Formula | C37H70O6 |
| Molecular Weight | 610.94800 |
| Flash Point | 256.6ºC |
| Exact Mass | 610.51700 |
| PSA | 78.90000 |
| LogP | 10.96710 |
| Index of Refraction | 1.462 |
| InChIKey | QFUWTJCNCQCYAM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OCCCC(CCCOC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC |
| HS Code | 2915900090 |
|---|
|
~%
Decanoic acid,1... CAS#:5453-35-0 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| heptane-1,4,7-triyl tridecanoate |
| 1,4,7-tris-decanoyloxy-heptane |