Perfluoro-3,6-dioxaoctane-1,8-dioic acid structure
|
Common Name | Perfluoro-3,6-dioxaoctane-1,8-dioic acid | ||
|---|---|---|---|---|
| CAS Number | 55621-21-1 | Molecular Weight | 322.06400 | |
| Density | 1.858g/cm3 | Boiling Point | 374.2ºC at 760mmHg | |
| Molecular Formula | C6H2F8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.1ºC | |
| Name | Perfluoro-3,6-dioxaoctane-1,8-dioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.858g/cm3 |
|---|---|
| Boiling Point | 374.2ºC at 760mmHg |
| Molecular Formula | C6H2F8O6 |
| Molecular Weight | 322.06400 |
| Flash Point | 180.1ºC |
| Exact Mass | 321.97200 |
| PSA | 93.06000 |
| LogP | 1.56000 |
| Index of Refraction | 1.353 |
| InChIKey | PXMYQUXWTLQKLL-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(=O)O |
| Hazard Codes | C,Xi |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[2-[carboxy(difluoro)methoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroacetic acid |