Benzene,2-chloro-4-nitro-1-phenoxy- structure
|
Common Name | Benzene,2-chloro-4-nitro-1-phenoxy- | ||
|---|---|---|---|---|
| CAS Number | 56966-69-9 | Molecular Weight | 249.65000 | |
| Density | 1.358g/cm3 | Boiling Point | 322.8ºC at 760mmHg | |
| Molecular Formula | C12H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149ºC | |
| Name | 2-chloro-4-nitro-1-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 322.8ºC at 760mmHg |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.65000 |
| Flash Point | 149ºC |
| Exact Mass | 249.01900 |
| PSA | 55.05000 |
| LogP | 4.56370 |
| Index of Refraction | 1.614 |
| InChIKey | ZIDYALDTDUSPFJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccccc2)c(Cl)c1 |
|
~91%
Benzene,2-chlor... CAS#:56966-69-9 |
| Literature: Bayer Aktiengesellschaft Patent: US5382686 A1, 1995 ; |
|
~%
Benzene,2-chlor... CAS#:56966-69-9 |
| Literature: Dr. Karl Thomae GmbH Patent: US5821240 A1, 1998 ; |
|
~69%
Benzene,2-chlor... CAS#:56966-69-9 |
| Literature: Steffen, Jamin D.; Coyle, Donna L.; Damodaran, Komath; Beroza, Paul; Jacobson, Myron K. Journal of Medicinal Chemistry, 2011 , vol. 54, # 15 p. 5403 - 5413 |
|
~%
Benzene,2-chlor... CAS#:56966-69-9 |
| Literature: Zeneca Limited Patent: US5821246 A1, 1998 ; |
|
~%
Benzene,2-chlor... CAS#:56966-69-9 |
| Literature: Dow Chem. Co. Patent: US1881074 , 1931 ; |
| 2-Chlor-4-nitro-diphenylaether |
| 2-chloro-4-nitrodiphenyl ether |
| 3-chloro-4-phenoxynitrobenzene |
| EINECS 260-482-5 |