benzoin structure
|
Common Name | benzoin | ||
|---|---|---|---|---|
| CAS Number | 5928-66-5 | Molecular Weight | 212.24400 | |
| Density | 1.18g/cm3 | Boiling Point | 342.999ºC at 760 mmHg | |
| Molecular Formula | C14H12O2 | Melting Point | 135-137ºC(lit.) | |
| MSDS | USA | Flash Point | 154.813ºC | |
| Name | (2R)-2-Hydroxy-1,2-diphenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 342.999ºC at 760 mmHg |
| Melting Point | 135-137ºC(lit.) |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 154.813ºC |
| Exact Mass | 212.08400 |
| PSA | 37.30000 |
| LogP | 2.60290 |
| Index of Refraction | 1.609 |
| InChIKey | ISAOCJYIOMOJEB-CYBMUJFWSA-N |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2914400090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (R)-(-)-2-hydroxy-1,2-diphenylethan-1-one |
| (R)-(-)-2-hydroxy-1,2-diphenylethanone |
| (R)-(-)-2-hydroxy-2-phenylacetophenone |
| UNII-BKM6YU2C5Y |
| Benzoin,(-) |
| MFCD00082818 |
| (R)-2-hydroxy-1,2-diphenylethane-1-one |