2,2,2-Trifluoroethyltrifluoromethanesulfonate structure
|
Common Name | 2,2,2-Trifluoroethyltrifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 6226-25-1 | Molecular Weight | 232.102 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 102.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C3H2F6O3S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 16.0±27.3 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2,2,2-Trifluoroethyl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 102.8±40.0 °C at 760 mmHg |
| Molecular Formula | C3H2F6O3S |
| Molecular Weight | 232.102 |
| Flash Point | 16.0±27.3 °C |
| Exact Mass | 231.962891 |
| PSA | 51.75000 |
| LogP | 2.26 |
| Vapour Pressure | 38.3±0.2 mmHg at 25°C |
| Index of Refraction | 1.317 |
| InChIKey | RTMMSCJWQYWMNK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCC(F)(F)F)C(F)(F)F |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H314-H330 |
| Precautionary Statements | P260-P280-P284-P301 + P310-P305 + P351 + P338-P310 |
| Hazard Codes | Xi: Irritant;T: Toxic;C: Corrosive; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN 3265 8 / PGII |
| RTECS | PB2775000 |
| HS Code | 2905590090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
A general strategy for the synthesis of cyclic N-aryl hydroxamic acids via partial nitro group reduction.
J. Org. Chem. 9th ed., 76 , 3484-3497, (2011) We describe a generalized approach to stereocontrolled synthesis of substituted cyclic hydroxamic acids (3-amino-1-hydroxy-3,4-dihydroquinolinones) by selective reduction of substituted 2-nitrophenyla... |
| 2,2,2-Trifluoroethyl trifluoromethanesulphonate |
| 2,2,2-Trifluoroethyl triflate |
| Methanesulfonic acid, 1,1,1-trifluoro-, 2,2,2-trifluoroethyl ester |
| EINECS 458-390-7 |
| MFCD00671579 |
| 2,2,2-Trifluoroethyl trifluoromethanesulfonate |
| trifluoromethylsulfonyloxy-2,2,2-trifluoroethane |
| 2,2,2-Trifluoroethyltrifluoromethanesulfonate |
| Methanesulfonic acid,trifluoro-,2,2,2-trifluoroethyl ester |
| 2,2,2-Trifluoroethyl trifluorometanesulfonic acid |
| Trifluoromethanesulfonic Acid 2,2,2-Trifluoroethyl Ester |
| trifluoroethyl triflate |
| 2,2,2-TRIFLUOROETHYLTRIFLATE |