2,3'-Bi-1H-indole,2,3-dihydro- structure
|
Common Name | 2,3'-Bi-1H-indole,2,3-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 6637-10-1 | Molecular Weight | 234.30 | |
| Density | 1.225g/cm3 | Boiling Point | 449.3ºC at 760 mmHg | |
| Molecular Formula | C16H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.5ºC | |
Use of 2,3'-Bi-1H-indole,2,3-dihydro-VPC13163 is a potent androgen receptor (AR) BF3 inhibitor with an IC50 of 0.31 µM. VPC13163 has anticancer effects[1]. |
| Name | 3-[(2R)-2,3-dihydro-1H-indol-2-yl]-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Description | VPC13163 is a potent androgen receptor (AR) BF3 inhibitor with an IC50 of 0.31 µM. VPC13163 has anticancer effects[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.31 µM (AR BF3)[1] |
| References |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 449.3ºC at 760 mmHg |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 |
| Flash Point | 225.5ºC |
| Exact Mass | 234.11600 |
| PSA | 27.82000 |
| LogP | 4.01520 |
| Index of Refraction | 1.699 |
| InChIKey | OGXXVLOAJZDVFY-UHFFFAOYSA-N |
| SMILES | c1ccc2c(c1)CC(c1c[nH]c3ccccc13)N2 |
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| 2,3-dihydro-1H,1'H-[2,3']biindolyl |
| 3-(indolin-2-yl)indole |
| 2,3-dihydro-(1,4)dioxino(2,3-c)pyridin-7-carbaldehyde |
| 2-(3-indolyl)-2,3-dihydroindole |
| 2H,3H-[1,4]dioxino[2,3-c]pyridine-7-carbaldehyde |
| 2,3-Dihydro-<2,3'-biindole> |
| 3-(indolin-2-yl)-1H-indole |
| 2-(3'-indolyl)indoline |
| 2-(indol-3-yl)-2,3-dihydroindole |
| 2,3-dihydro-[1,4]dioxino[2,3-c]pyridine-7-carboxaldehyde |
| 2,3-dihydro[1,4]dioxino[2,3-c]pyridine-7-carbaldehyde |