Benzoic acid,3,4,5-tris(phenylmethoxy)-, methyl ester structure
|
Common Name | Benzoic acid,3,4,5-tris(phenylmethoxy)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 70424-94-1 | Molecular Weight | 454.51400 | |
| Density | 1.191 g/cm3 | Boiling Point | 584.5ºC at 760 mmHg | |
| Molecular Formula | C29H26O5 | Melting Point | 98ºC | |
| MSDS | N/A | Flash Point | 249.3ºC | |
Use of Benzoic acid,3,4,5-tris(phenylmethoxy)-, methyl esterAn intermediate in the production of Gallic Acid derivatives |
| Name | Methyl 3,4,5-Tris(benzyloxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191 g/cm3 |
|---|---|
| Boiling Point | 584.5ºC at 760 mmHg |
| Melting Point | 98ºC |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.51400 |
| Flash Point | 249.3ºC |
| Exact Mass | 454.17800 |
| PSA | 53.99000 |
| LogP | 6.21020 |
| Index of Refraction | 1.605 |
| InChIKey | MAUSJTNDKNFSEU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| Precursor 5 | |
|---|---|
| DownStream 8 | |
| methyl 3,4,5-tris(phenylmethoxy)benzoate |