2-phenyl-1,3-thiazole-4-carbohydrazide structure
|
Common Name | 2-phenyl-1,3-thiazole-4-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 7113-12-4 | Molecular Weight | 219.26300 | |
| Density | 1.329g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9N3OS | Melting Point | 136-138ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Melting Point | 136-138ºC |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.26300 |
| Exact Mass | 219.04700 |
| PSA | 96.25000 |
| LogP | 2.50480 |
| Index of Refraction | 1.645 |
| InChIKey | UOOVLEVHLHNGPC-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1csc(-c2ccccc2)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
|
~82%
2-phenyl-1,3-th... CAS#:7113-12-4 |
| Literature: Thore; Gupta, Sunil V.; Baheti, Kamalkishor G. Medicinal Chemistry Research, 2013 , vol. 22, # 8 p. 3802 - 3811 |
|
~%
2-phenyl-1,3-th... CAS#:7113-12-4 |
| Literature: Hall; Walker Journal of the Chemical Society. Perkin transactions 1, 1966 , vol. 16, p. 1357 - 1360 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-phenylthiazole-4-carbohydrazide |
| 2-phenyl-thiazole-4-carboxylic acid hydrazide |
| 2-Phenyl-thiazol-4-carbonsaeure-hydrazid |
| 2-phenyl-1,3-thiazole-4-carboxylic acid hydrazide |