N-(3-Acetyl-4-hydroxyphenyl)acetamide structure
|
Common Name | N-(3-Acetyl-4-hydroxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 7298-67-1 | Molecular Weight | 193.199 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 414.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO3 | Melting Point | 167-168ºC | |
| MSDS | N/A | Flash Point | 204.4±25.9 °C | |
| Name | N1-(3-Acetyl-4-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.4±35.0 °C at 760 mmHg |
| Melting Point | 167-168ºC |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.199 |
| Flash Point | 204.4±25.9 °C |
| Exact Mass | 193.073898 |
| PSA | 66.40000 |
| LogP | 1.39 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | DIQSYMRVTOVKQT-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(O)c(C(C)=O)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 22-26-36/37/39 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acetamide, N-(3-acetyl-4-hydroxyphenyl)- |
| N-(3-Acetyl-4-hydroxyphenyl)acetamide |