Hycrecrellin A structure
|
Common Name | Hycrecrellin A | ||
|---|---|---|---|---|
| CAS Number | 77029-83-5 | Molecular Weight | 546.521 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 894.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H26O10 | Melting Point | 245-250ºC | |
| MSDS | N/A | Flash Point | 299.6±27.8 °C | |
Use of Hycrecrellin AHypocrellin A, a naturally occurring PKC inhibitor, has many biological and pharmacological properties, such as antitumour, antiviral, antibacterial, and antileishmanial activities. Hypocrellin A is a promising photosensitizer for anticancer photodynamic therapy (PDT)[1][2][3][4]. |
| Name | hypocrellin a |
|---|---|
| Synonym | More Synonyms |
| Description | Hypocrellin A, a naturally occurring PKC inhibitor, has many biological and pharmacological properties, such as antitumour, antiviral, antibacterial, and antileishmanial activities. Hypocrellin A is a promising photosensitizer for anticancer photodynamic therapy (PDT)[1][2][3][4]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 894.0±65.0 °C at 760 mmHg |
| Melting Point | 245-250ºC |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.521 |
| Flash Point | 299.6±27.8 °C |
| Exact Mass | 546.152588 |
| PSA | 148.82000 |
| LogP | 3.42 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | VANSZAOQCMTTPB-UHFFFAOYSA-N |
| SMILES | COc1c(O)c2c(=O)cc(OC)c3c4c(OC)cc(=O)c5c(O)c(OC)c6c(c(c1CC(C)(O)C6C(C)=O)c23)c54 |
| Safety Phrases | 22-24/25 |
|---|
| 1-Acetyl-2,5,12-trihydroxy-4,8,9,13-tetramethoxy-2-methyl-2,3-dihydro-1H-cyclohepta[ghi]perylene-6,11-dione |
| (1S,2R)-1-Acetyl-2,5,12-trihydroxy-4,8,9,13-tetramethoxy-2-methyl-2,3-dihydro-1H-cyclohepta[ghi]perylene-6,11-dione |
| 1H-Cyclohepta[ghi]perylene-6,11-dione, 1-acetyl-2,3-dihydro-2,5,12-trihydroxy-4,8,9,13-tetramethoxy-2-methyl-, (1S,2R)- |
| 1H-Cyclohepta[ghi]perylene-6,11-dione, 1-acetyl-2,3-dihydro-2,5,12-trihydroxy-4,8,9,13-tetramethoxy-2-methyl- |
| hypocrellin |