P18IN 011 structure
|
Common Name | P18IN 011 | ||
|---|---|---|---|---|
| CAS Number | 77408-67-4 | Molecular Weight | 332.33100 | |
| Density | 1.468g/cm3 | Boiling Point | 609.3ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.3ºC | |
Use of P18IN 011P18IN011 is a novel p18(INK4C) inhibitor. |
| Name | 1,2-benzoxazol-3-yl 4-acetamidobenzenesulfonate |
|---|
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 609.3ºC at 760 mmHg |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.33100 |
| Flash Point | 322.3ºC |
| Exact Mass | 332.04700 |
| PSA | 106.88000 |
| LogP | 3.70770 |
| Index of Refraction | 1.653 |
| InChIKey | SIXNKGXJEIVCDH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2noc3ccccc23)cc1 |