Okadaic acid structure
|
Common Name | Okadaic acid | ||
|---|---|---|---|---|
| CAS Number | 78111-17-8 | Molecular Weight | 805.003 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 921.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C44H68O13 | Melting Point | 164-166ºC | |
| MSDS | Chinese USA | Flash Point | 269.4±27.8 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of Okadaic acidOkadaic acid is extracted from black sponges of the genus Halichondria. Okadaic acid is a non-comepetitive, selective and reversible serine/threonine-specific protein phosphatases 1 (PP1), PP2A and PP3 inhibitor with IC50s of 10-15 nM, 0.5 nM and 4 nM, respectively.[1][2] Okadaic acid eliminate metazoan symbionts/parasites by apoptosis[3]. |
| Name | okadaic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Okadaic acid is extracted from black sponges of the genus Halichondria. Okadaic acid is a non-comepetitive, selective and reversible serine/threonine-specific protein phosphatases 1 (PP1), PP2A and PP3 inhibitor with IC50s of 10-15 nM, 0.5 nM and 4 nM, respectively.[1][2] Okadaic acid eliminate metazoan symbionts/parasites by apoptosis[3]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 10-15 nM (PP1), 0.5 nM (PP2) and 4 nM (PP3)[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 921.6±65.0 °C at 760 mmHg |
| Melting Point | 164-166ºC |
| Molecular Formula | C44H68O13 |
| Molecular Weight | 805.003 |
| Flash Point | 269.4±27.8 °C |
| Exact Mass | 804.466003 |
| PSA | 182.83000 |
| LogP | 4.21 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | QNDVLZJODHBUFM-WFXQOWMNSA-N |
| SMILES | C=C1C(O)C2OC3(CCC(C=CC(C)C4CC(C)=CC5(OC(CC(C)(O)C(=O)O)CCC5O)O4)O3)CCC2OC1C(O)CC(C)C1OC2(CCCCO2)CCC1C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H315 |
| Precautionary Statements | Missing Phrase - N15.00950417-P261-P280-P302 + P352 + P312-P304 + P340 + P312-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S26;S45;S36/S37 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | AA8227800 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 29321900 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Uptake of neutrophil-derived Ym1 protein distinguishes wound macrophages in the absence of interleukin-4 signaling in murine wound healing.
Am. J. Pathol. 184(12) , 3249-61, (2014) The determination of regenerative wound-healing macrophages as alternatively activated macrophages is currently questioned by the absence of IL-4 in wound tissue. Yet, murine wound tissue expressed hi... |
|
|
Multiple assembly mechanisms anchor the KMN spindle checkpoint platform at human mitotic kinetochores.
J. Cell Biol. 208(2) , 181-96, (2015) During mitosis, the spindle checkpoint senses kinetochores not properly attached to spindle microtubules and prevents precocious sister-chromatid separation and aneuploidy. The constitutive centromere... |
|
|
Direct cellular delivery of human proteasomes to delay tau aggregation.
Nat. Commun. 5 , 5633, (2014) The 26S proteasome is the primary machinery that degrades ubiquitin (Ub)-conjugated proteins, including many proteotoxic proteins implicated in neurodegeneraton. It has been suggested that the elevati... |
| (2R)-2-hydroxy-3-[(2S,5R,6R,8S)-5-hydroxy-8-{(2R,3E)-4-[(2R,4a'R,5R,6'S,8'R,8a'S)-8'-hydroxy-6'-{(1S,3S)-1-hydroxy-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undec-2-yl]butyl}-7'-methylideneoctahydro-3H,3'H-spiro[furan-2,2'-pyrano[3,2-b]pyran]-5-yl]but-3-en-2-yl}-10-methyl-1,7-dioxaspiro[5.5]undec-10-en-2-yl]-2-methylpropanoic acid |
| Halochondrine A |
| Okadic acid |
| 9,10-deepithio-9,10-didehydroacanthifolicin |
| okadaic acd |
| MFCD00083455 |
| 1,7-Dioxaspiro[5.5]undec-10-ene-2-propanoic acid, α,5-dihydroxy-α,10-dimethyl-8-[(1R,2E)-1-methyl-3-[(2R,4a'R,5R,6'S,8'R,8a'S)-octahydro-8'-hydroxy-6'-[(1S,3S)-1-hydroxy-3-[(2S,3R,6S)-3-methyl -1,7-dioxaspiro[5.5]undec-2-yl]butyl]-7'-methylenespiro[furan-2(3H),2'(3'H)-pyrano[3,2-b]pyran]-5-yl]-2-propen-1-yl]-, (αR,2S,5R,6R,8S)- |
| Okadaic acid |
| OKADAICACID,HIGHPURITY |
| Ocadaic Acid |
| (2R)-2-Hydroxy-3-[(2S,5R,6R,8S)-5-hydroxy-8-{(2R,3E)-4-[(2R,4a'R,5R,6'S,8'R,8a'S)-8'-hydroxy-6'-{(1S,3S)-1-hydroxy-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undec-2-yl]butyl}-7'-methyleneoctahydro-3H,3'H-spiro[furan-2,2'-pyrano[3,2-b]pyran]-5-yl]-3-buten-2-yl}-10-methyl-1,7-dioxaspiro[5.5]undec-10-en-2-yl]-2-methylpropanoic acid |
| 1,7-Dioxaspiro[5.5]undec-10-ene-2-propanoic acid, α,5-dihydroxy-α,10-dimethyl-8-[(1R,2E)-1-methyl-3-[(2R,4a'R,5R,6'S,8'R,8a'S)-octahydro-8'-hydroxy-6'-[(1S,3S)-1-hydroxy-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undec-2-yl]butyl]-7'-methylenespiro[furan-2(3H),2'(3'H)-pyrano[3,2-b]pyran]-5-yl]-2-propen-1-yl]-, (αR,2S,5R,6R,8S)- |