SBI-477
Modify Date: 2025-08-25 18:30:29
SBI-477 structure
|
Common Name | SBI-477 | ||
|---|---|---|---|---|
| CAS Number | 781628-99-7 | Molecular Weight | 483.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25N3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SBI-477SBI-477 is a chemical probe stimulated insulin signaling by deactivating the transcription factor MondoA, leading to reduced expression of the insulin pathway suppressors thioredoxin-interacting protein (TXNIP) and arrestin domain–containing 4 (ARRDC4). SBI-477 coordinately inhibits triacylglyceride (TAG) synthesis and enhances basal glucose uptake in human skeletal myocytes[1]. |
| Name | SBI-477 |
|---|
| Description | SBI-477 is a chemical probe stimulated insulin signaling by deactivating the transcription factor MondoA, leading to reduced expression of the insulin pathway suppressors thioredoxin-interacting protein (TXNIP) and arrestin domain–containing 4 (ARRDC4). SBI-477 coordinately inhibits triacylglyceride (TAG) synthesis and enhances basal glucose uptake in human skeletal myocytes[1]. |
|---|---|
| Related Catalog | |
| Target |
MondoA[1] |
| References |
| Molecular Formula | C24H25N3O6S |
|---|---|
| Molecular Weight | 483.54 |
| InChIKey | SJPVXFZDWAIFFT-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2csc(NC(=O)c3ccc(OCC(=O)N4CCOCC4)c(OC)c3)n2)cc1 |