M4 mAChR agonist-1 structure
|
Common Name | M4 mAChR agonist-1 | ||
|---|---|---|---|---|
| CAS Number | 785705-53-5 | Molecular Weight | 290.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of M4 mAChR agonist-1M4 mAChR agonist-1 (compound 10a) is a potent M4 mAChR agonist with an EC50 >10 μM for human M4[1]. |
| Name | M4 mAChR agonist-1 |
|---|
| Description | M4 mAChR agonist-1 (compound 10a) is a potent M4 mAChR agonist with an EC50 >10 μM for human M4[1]. |
|---|---|
| Related Catalog | |
| Target |
EC50: >10 μM (human M4)[1] |
| References |
| Molecular Formula | C14H18N4OS |
|---|---|
| Molecular Weight | 290.38 |
| InChIKey | KOMCJGHOPXNACW-UHFFFAOYSA-N |
| SMILES | Cc1sc2ncnc(N3CCC(C(N)=O)CC3)c2c1C |