4-(Methylamino)-3-nitrobenzoyl chloride structure
|
Common Name | 4-(Methylamino)-3-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 82357-48-0 | Molecular Weight | 214.606 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 353.3±32.0 °C at 760 mmHg | |
| Molecular Formula | C8H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.5±25.1 °C | |
| Name | 4-(methylamino)-3-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.3±32.0 °C at 760 mmHg |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.606 |
| Flash Point | 167.5±25.1 °C |
| Exact Mass | 214.014526 |
| PSA | 74.92000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | LIRZLGQEZXAOQR-UHFFFAOYSA-N |
| SMILES | CNc1ccc(C(=O)Cl)cc1[N+](=O)[O-] |
| Hazard Codes | C |
|---|
|
~99%
4-(Methylamino)... CAS#:82357-48-0 |
| Literature: Dumont-Hornebeck, Beatrice; Strube, Yi Ning; Vasilescu, Daniela; Jean-Claude, Bertrand Jacques Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 20 p. 2325 - 2327 |
|
~%
4-(Methylamino)... CAS#:82357-48-0 |
| Literature: WO2009/111997 A1, ; Page/Page column 8-9 ; |
|
~%
4-(Methylamino)... CAS#:82357-48-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 20 p. 2325 - 2327 |
|
~%
4-(Methylamino)... CAS#:82357-48-0 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 7 p. 1924 - 1928 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| 4-methylamino-3-nitro-benzoic acid chloride |
| Benzoyl chloride,4-(methylamino)-3-nitro |
| 4-(METHYLAMINO)-3-NITRO-BENZOYL CHLORIDE |
| 3-NITRO-4-METHYLAMINO-BENZOYLCHLORIDE |
| 3-Nitro-4-methylamino-benzoylchlorid |
| 4-(Methylamino)-3-nitrobenzoyl chloride |
| Benzoyl chloride, 4-(methylamino)-3-nitro- |