BML 284 structure
|
Common Name | BML 284 | ||
|---|---|---|---|---|
| CAS Number | 853220-52-7 | Molecular Weight | 350.371 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 623.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C19H18N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.8±34.3 °C | |
Use of BML 284BML-284 is selective and cell-permeable Wnt signaling activator. |
| Name | N4-(1,3-Benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)-2,4-pyrimidinediamine |
|---|---|
| Synonym | More Synonyms |
| Description | BML-284 is selective and cell-permeable Wnt signaling activator. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 623.4±65.0 °C at 760 mmHg |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.371 |
| Flash Point | 330.8±34.3 °C |
| Exact Mass | 350.137878 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | FABQUVYDAXWUQP-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2cc(NCc3ccc4c(c3)OCO4)nc(N)n2)c1 |
| Storage condition | -20℃ |
| N-(1,3-Benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)-2,4-pyrimidinediamine |
| MFCD09908087 |
| 2,4-Pyrimidinediamine, N-(1,3-benzodioxol-5-ylmethyl)-6-(3-methoxyphenyl)- |
| BML-284 |
| Wnt agonist 1 |
| CID 11210285 hydrochloride |