Amino-PEG4-C1-Boc structure
|
Common Name | Amino-PEG4-C1-Boc | ||
|---|---|---|---|---|
| CAS Number | 864680-64-8 | Molecular Weight | 307.38 | |
| Density | 1.051±0.06 g/cm3 | Boiling Point | 386.1±32.0 °C | |
| Molecular Formula | C14H29NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Amino-PEG4-C1-BocAmino-PEG4-C1-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Amino-PEG4-C1-Boc |
|---|
| Description | Amino-PEG4-C1-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Density | 1.051±0.06 g/cm3 |
|---|---|
| Boiling Point | 386.1±32.0 °C |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.38 |
| InChIKey | WPWIGTOQNITKON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCN |