HS-PEG8-CH2CH2COOH structure
|
Common Name | HS-PEG8-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 866889-02-3 | Molecular Weight | 458.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H38O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HS-PEG8-CH2CH2COOHThiol-PEG8-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3-[2-[2-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Thiol-PEG8-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H38O10S |
|---|---|
| Molecular Weight | 458.56400 |
| Exact Mass | 458.21900 |
| PSA | 149.94000 |
| LogP | 0.52370 |
| InChIKey | SKYJRDAORYSCAL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCS |
| Hazard Codes | Xi |
|---|
| AmbotzPEG1120 |
| PEG thiol acid |
| 4,7,10,13,16,19,22,25-Octaoxaheptacosanoicacid,27-mercapto |