Furowanin A structure
|
Common Name | Furowanin A | ||
|---|---|---|---|---|
| CAS Number | 911004-72-3 | Molecular Weight | 438.47 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 697.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.3±25.0 °C | |
Use of Furowanin AFurowanin A is a flavonoid with anti-neoplastic effects. Furowanin A inhibits STAT3/Mcl-1 axis to suppress proliferation, block cell cycle progression, induce apoptosis and promote autophagy. Furowanin A potently inhibits colorectal cancer (CRC) cells[1]. |
| Name | Furowanin A |
|---|---|
| Synonym | More Synonyms |
| Description | Furowanin A is a flavonoid with anti-neoplastic effects. Furowanin A inhibits STAT3/Mcl-1 axis to suppress proliferation, block cell cycle progression, induce apoptosis and promote autophagy. Furowanin A potently inhibits colorectal cancer (CRC) cells[1]. |
|---|---|
| Related Catalog | |
| Target |
Mcl-1 STAT3 |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 697.7±55.0 °C at 760 mmHg |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.47 |
| Flash Point | 240.3±25.0 °C |
| Exact Mass | 438.167847 |
| PSA | 120.36000 |
| LogP | 5.34 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.661 |
| InChIKey | NMEQUFXTRAXRGN-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c2c(c(O)c3c(=O)c(-c4ccc(O)c(O)c4)coc13)CC(C(C)(C)O)O2 |
| Hazard Codes | Xi |
|---|
| 6-(3,4-Dihydroxyphenyl)-4-hydroxy-2-(2-hydroxy-2-propanyl)-9-(3-methyl-2-buten-1-yl)-2,3-dihydro-5H-furo[3,2-g]chromen-5-one |
| 5H-Furo[3,2-g][1]benzopyran-5-one, 6-(3,4-dihydroxyphenyl)-2,3-dihydro-4-hydroxy-2-(1-hydroxy-1-methylethyl)-9-(3-methyl-2-buten-1-yl)- |