PF-3893787 structure
|
Common Name | PF-3893787 | ||
|---|---|---|---|---|
| CAS Number | 943057-12-3 | Molecular Weight | 262.354 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 541.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C13H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3±32.9 °C | |
Use of PF-3893787PF-3893787 (ZPL 3893787) is a potent and selective H4 receptor antagonist with binding Ki of 2.4 nM. |
| Name | D65H9YE9VU |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.5±60.0 °C at 760 mmHg |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.354 |
| Flash Point | 281.3±32.9 °C |
| Exact Mass | 262.190582 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | ISBHYKVAFKTATD-SNVBAGLBSA-N |
| SMILES | CNC1CCN(c2cc(NCC3CC3)nc(N)n2)C1 |
| D65H9YE9VU |
| N4-(Cyclopropylmethyl)-6-[(3R)-3-(methylamino)-1-pyrrolidinyl]-2,4-pyrimidinediamine |
| ZPL-3893787 |
| 2,4-Pyrimidinediamine, N4-(cyclopropylmethyl)-6-[(3R)-3-(methylamino)-1-pyrrolidinyl]- |