ALX-1393 structure
|
Common Name | ALX-1393 | ||
|---|---|---|---|---|
| CAS Number | 949164-09-4 | Molecular Weight | 395.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ALX-1393ALX-1393, a selective GlyT2 inhibitor, has an antinociceptive effect on thermal, mechanical, and chemical stimulations in a rat acute pain model[1]. |
| Name | O-[(2-benzyloxyphenyl)(3-fluorophenyl)methyl]-L-serine |
|---|
| Description | ALX-1393, a selective GlyT2 inhibitor, has an antinociceptive effect on thermal, mechanical, and chemical stimulations in a rat acute pain model[1]. |
|---|---|
| Related Catalog | |
| Target |
GlyT2[1] |
| In Vivo | ALX1393 (i.c.v.; 25, 50, and 100 μg) in normal rats suppresses the late-phase response in the formalin test but does not affect motor performance. ALX1393 inhibits mechanical and cold hyperalgesia in a dose-dependent manner[2]. |
| References |
| Molecular Formula | C23H22FNO4 |
|---|---|
| Molecular Weight | 395.42300 |
| Exact Mass | 395.15300 |
| PSA | 81.78000 |
| LogP | 4.62290 |
| InChIKey | ADUSZEGHFWRTQS-PSDZMVHGSA-N |
| SMILES | NC(COC(c1cccc(F)c1)c1ccccc1OCc1ccccc1)C(=O)O |