MPC-3100 structure
|
Common Name | MPC-3100 | ||
|---|---|---|---|---|
| CAS Number | 958025-66-6 | Molecular Weight | 549.441 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 772.4±70.0 °C at 760 mmHg | |
| Molecular Formula | C22H25BrN6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 420.9±35.7 °C | |
Use of MPC-3100MPC-3100 is an orally bioavailable, synthetic, second-generation small-molecule inhibitor of Hsp90 with potential antineoplastic activity[1]. |
| Name | (2S)-1-[4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]-2-hydroxypropan-1-one |
|---|
| Description | MPC-3100 is an orally bioavailable, synthetic, second-generation small-molecule inhibitor of Hsp90 with potential antineoplastic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 772.4±70.0 °C at 760 mmHg |
| Molecular Formula | C22H25BrN6O4S |
| Molecular Weight | 549.441 |
| Flash Point | 420.9±35.7 °C |
| Exact Mass | 548.084106 |
| PSA | 153.92000 |
| LogP | 3.11 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.778 |
| InChIKey | CVBWTNHDKVVFMI-LBPRGKRZSA-N |
| SMILES | CC(O)C(=O)N1CCC(CCn2c(Sc3cc4c(cc3Br)OCO4)nc3c(N)ncnc32)CC1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |