3,5-Diiodo-L-tyrosine dihydrate structure
|
Common Name | 3,5-Diiodo-L-tyrosine dihydrate | ||
|---|---|---|---|---|
| CAS Number | 300-39-0 | Molecular Weight | 469.012 | |
| Density | 2.405g/cm3 | Boiling Point | 410.5ºC at 760 mmHg | |
| Molecular Formula | C9H13I2NO5 | Melting Point | 200 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 202.1ºC | |
Use of 3,5-Diiodo-L-tyrosine dihydrate3,5-Diiodo-L-tyrosine is a tyrosine derivative[1]. |
| Name | 3,5-diiodo-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Description | 3,5-Diiodo-L-tyrosine is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 2.405g/cm3 |
|---|---|
| Boiling Point | 410.5ºC at 760 mmHg |
| Melting Point | 200 °C (dec.)(lit.) |
| Molecular Formula | C9H13I2NO5 |
| Molecular Weight | 469.012 |
| Flash Point | 202.1ºC |
| Exact Mass | 468.888306 |
| PSA | 102.01000 |
| LogP | 2.12750 |
| Index of Refraction | 1.2 ° (C=5, 1mol/L HCl) |
| InChIKey | NYPYHUZRZVSYKL-ZETCQYMHSA-N |
| SMILES | NC(Cc1cc(I)c(O)c(I)c1)C(=O)O |
| Storage condition | 2~8°C |
| Water Solubility | slightly soluble |
| Hazard Codes | Xi:Irritant |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 2922509090 |
|
~74%
3,5-Diiodo-L-ty... CAS#:300-39-0 |
| Literature: Zewail; Shalaby; Megahed Egyptian Journal of Chemistry, 2012 , vol. 55, # 6 p. 639 - 647 |
|
~%
3,5-Diiodo-L-ty... CAS#:300-39-0 |
| Literature: Australian Journal of Chemistry, , vol. 34, # 5 p. 1147 - 1151 |
|
~%
3,5-Diiodo-L-ty... CAS#:300-39-0 |
| Literature: Biochemical Journal, , vol. 22, p. 1433 Biochemische Zeitschrift, , vol. 211, p. 179 |
|
~37%
3,5-Diiodo-L-ty... CAS#:300-39-0 |
| Literature: Zeitschrift fuer Naturforschung, Teil B: Anorganische Chemie, Organische Chemie, , vol. 39, # 1 p. 101 - 104 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-Diiodo-L-tyrosine dihydrate |
| H-L-TYR(3,5-I2)-OH |
| AGONTAN |
| EINECS 206-092-0 |
| L-4-hydroxy-3,5-diiodo-phenylalanine |
| MFCD00016542 |
| 3,5-diiodotyrozine |
| DITYRIN |
| L-Tyrosine, 3,5-diiodo-, hydrate (1:2) |
| diiodotyrosine |
| L-3,5-Diiodotyrosine |
| 3',5'-diiodo-L-tyrosine |
| 3,5-Diiodo-L-tyrosine |
| H-Tyr(3,5-DI-I)-OH |
| L-Diiodotyrosine |
| 3,5-Diiodotyrocine |
| H-TYR(3,5-I2)-OH |
| 3,5-Iodo-L-tyrosine |
| IODOGORGOIC ACID |
| (S)-2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid |