Desethyl KBT-3022 structure
|
Common Name | Desethyl KBT-3022 | ||
|---|---|---|---|---|
| CAS Number | 101001-72-3 | Molecular Weight | 420.48100 | |
| Density | 1.29g/cm3 | Boiling Point | 630.3ºC at 760mmHg | |
| Molecular Formula | C23H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335ºC | |
Use of Desethyl KBT-3022Desethyl KBT-3022 is the main active metabolite of the new antiplatelet agent, KBT-3022. |
| Name | 2-[2-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]pyrrol-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Desethyl KBT-3022 is the main active metabolite of the new antiplatelet agent, KBT-3022. |
|---|---|
| Related Catalog | |
| In Vitro | Pretreatment with desethyl KBT-3022 0.1, 0.3 and 1 mg/kg, i.v. prolongs the time required to achieve thrombotic occlusion in the femoral artery and inhibits collagen-induced platelet aggregation in whole blood ex vivo, each in a dose-dependent manner. Desethyl KBT-3022 inhibits the thrombin-induced aggregation of washed platelets in a concentration-dependent manner 1–40 μM[1]. |
| References |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 630.3ºC at 760mmHg |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.48100 |
| Flash Point | 335ºC |
| Exact Mass | 420.11400 |
| PSA | 101.82000 |
| LogP | 5.04740 |
| Vapour Pressure | 9.4E-17mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | KJSPVPWIMGZXOF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(-c3cccn3CC(=O)O)sc2-c2ccc(OC)cc2)cc1 |
| 1H-Pyrrole-1-aceticacid,2-[4,5-bis(4-methoxyphenyl)-2-thiazolyl] |
| Desethyl KB 3022 |
| 2-(4,5-Bis(4-methoxylphenyl)thiazol-2-yl)pyrrol-1-ylacetic acid |
| Desethyl kbt-3022 |