1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid structure
|
Common Name | 1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid | ||
|---|---|---|---|---|
| CAS Number | 113558-03-5 | Molecular Weight | 504.698 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 619.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.2±28.0 °C | |
Use of 1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid is a Triterpenoid that isolated from the plant of Agrimonia Pilosa with antimalarial and antidiabetic activities[1]. |
| Name | 1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2,3,19-Tetrahydroxy-12-ursen-28-oic acid is a Triterpenoid that isolated from the plant of Agrimonia Pilosa with antimalarial and antidiabetic activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 619.1±55.0 °C at 760 mmHg |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.698 |
| Flash Point | 342.2±28.0 °C |
| Exact Mass | 504.345093 |
| PSA | 118.22000 |
| LogP | 5.27 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | VULLSLYDWNGNKZ-KMTXXZIPSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)C(O)C(O)C(O)C(C)(C)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| (1β,2α,3β)-1,2,3,19-Tetrahydroxyurs-12-en-28-oic acid |
| (5ξ,18α)-1,2,3,19-Tetrahydroxyurs-12-en-28-oic acid |
| Urs-12-en-28-oic acid, 1,2,3,19-tetrahydroxy-, (5ξ,18α)- |
| Urs-12-en-28-oic acid, 1,2,3,19-tetrahydroxy-, (1β,2α,3β)- |