Oroxin B structure
|
Common Name | Oroxin B | ||
|---|---|---|---|---|
| CAS Number | 114482-86-9 | Molecular Weight | 594.518 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 957.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C27H30O15 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 318.1±27.8 °C | |
Use of Oroxin BOroxin B (OB) is a flavonoid isolated from traditional Chinese herbal medicine Oroxylum indicum (L.) Vent. Oroxin B (OB) possesses obvious inhibitory effect and induces early apoptosis rather than late apoptosis on liver cancer cells through upregulation of PTEN, down regulation of COX-2, VEGF, PI3K, and p-AKT[1].Oroxin B (OB) selectively induces tumor-suppressive ER stress in malignant lymphoma cells[2]. |
| Name | 5,6-Dihydroxy-4-oxo-2-phenyl-4H-chromen-7-yl 6-O-β-D-glucopyranos yl-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Oroxin B (OB) is a flavonoid isolated from traditional Chinese herbal medicine Oroxylum indicum (L.) Vent. Oroxin B (OB) possesses obvious inhibitory effect and induces early apoptosis rather than late apoptosis on liver cancer cells through upregulation of PTEN, down regulation of COX-2, VEGF, PI3K, and p-AKT[1].Oroxin B (OB) selectively induces tumor-suppressive ER stress in malignant lymphoma cells[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 957.5±65.0 °C at 760 mmHg |
| Molecular Formula | C27H30O15 |
| Molecular Weight | 594.518 |
| Flash Point | 318.1±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 249.20000 |
| LogP | -0.57 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.745 |
| InChIKey | HAYLVXFWJCKKDW-IJTBWITGSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OC3OC(COC4OC(CO)C(O)C(O)C4O)C(O)C(O)C3O)c(O)c(O)c12 |
| Storage condition | -20 °C |
| Safety Phrases | 24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 29389090 |
| 5,6-Dihydroxy-4-oxo-2-phenyl-4H-chromen-7-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| Baicalin-7-diglucoside |
| Oroxin B |
| 4H-1-Benzopyran-4-one, 7-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5,6-dihydroxy-2-phenyl- |