WAY208466 dihydrochloride
Modify Date: 2025-11-25 19:03:31
WAY208466 dihydrochloride structure
|
Common Name | WAY208466 dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1207064-61-6 | Molecular Weight | 420.329 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20Cl2FN3O2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of WAY208466 dihydrochlorideWAY 208466 dihydrochloride is a potent and selective 5-HT6 receptor agonist (EC50=7.3 nM for the human 5-HT6 receptor). WAY-208466 dihydrochloride elevates cortical GABA levels in rat frontal cortex[1]. WAY 208466 dihydrochloride exhibits antidepressant and anxiolytic-like effects[2]. |
| Name | WAY 208466 dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | WAY 208466 dihydrochloride is a potent and selective 5-HT6 receptor agonist (EC50=7.3 nM for the human 5-HT6 receptor). WAY-208466 dihydrochloride elevates cortical GABA levels in rat frontal cortex[1]. WAY 208466 dihydrochloride exhibits antidepressant and anxiolytic-like effects[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H20Cl2FN3O2S |
|---|---|
| Molecular Weight | 420.329 |
| Exact Mass | 419.063721 |
| InChIKey | BAOHMLBVCLITHA-UHFFFAOYSA-N |
| SMILES | CN(C)CCn1cc(S(=O)(=O)c2cccc(F)c2)c2cccnc21.Cl.Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| MFCD20926423 |
| 2-{3-[(3-Fluorophenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-1-yl}-N,N-dimethylethanamine dihydrochloride |
| WAY 208466 dihydrochloride |
| WAY-208466 (hydrochloride) |
| 1H-Pyrrolo[2,3-b]pyridine-1-ethanamine, 3-[(3-fluorophenyl)sulfonyl]-N,N-dimethyl-, hydrochloride (1:2) |
| WAY-208466 DIHYDROCHLORIDE |