Compound 10 structure
|
Common Name | Compound 10 | ||
|---|---|---|---|---|
| CAS Number | 123021-85-2 | Molecular Weight | 279.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9NO5S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Compound 10GPR35 agonist 3 is a synthetic GPR35 agonist with an EC50value of 1.4 μM. GPR35 agonist 3 can be used for the research of various diseases, such as gastric cancer, type 2 diabetes, cardiovascular diseases, immune system and peripheral nervous system[1]. |
| Name | 2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | GPR35 agonist 3 is a synthetic GPR35 agonist with an EC50value of 1.4 μM. GPR35 agonist 3 can be used for the research of various diseases, such as gastric cancer, type 2 diabetes, cardiovascular diseases, immune system and peripheral nervous system[1]. |
|---|---|
| Related Catalog | |
| Target |
EC50: 1.4 μM (GPR35)[1]. Ki: 0.0508 μM (GPR35)[1]. IC50: 0.349 μM (GPR35)[1]. |
| In Vitro | GPR35 agonist 3 shows GPR35 agonist potency with an EC50 value of 1.4 μM[1]. GPR35 agonist 3 has affinity and potency for GPR35 with values of 0.0508μM (Ki) and 0.349 μM (IC50)[1]. |
| Molecular Formula | C12H9NO5S |
|---|---|
| Molecular Weight | 279.26900 |
| Exact Mass | 279.02000 |
| PSA | 121.49000 |
| LogP | 1.74980 |
| InChIKey | WXMCOLGPDOYHNK-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(C=C2SC(=O)NC2=O)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 2-[4-[(2,4-Dioxo-5-thiazolidinylidene)methyl]phenoxy]-acetic acid |
| 2-(4-((2,4-dioxothiazolidin-5-ylidene)methyl)phenoxy)acetic acid |
| GPR35 Agonist,Compound 10 |