CCG 2046 structure
|
Common Name | CCG 2046 | ||
|---|---|---|---|---|
| CAS Number | 13017-69-1 | Molecular Weight | 198.22400 | |
| Density | 1.17g/cm3 | Boiling Point | 467.4ºC at 760mmHg | |
| Molecular Formula | C11H10N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.1ºC | |
Use of CCG 2046CCG-2046 is a RGS4 inhibitor with an IC50 of 4.3 μM against RGS4-Gαo interaction signal[1]. |
| Name | 3-methyl-3-propylcyclopropane-1,1,2,2-tetracarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | CCG-2046 is a RGS4 inhibitor with an IC50 of 4.3 μM against RGS4-Gαo interaction signal[1]. |
|---|---|
| Related Catalog | |
| Target |
RGS4:4.3 μM (IC50) |
| References |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 467.4ºC at 760mmHg |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.22400 |
| Flash Point | 240.1ºC |
| Exact Mass | 198.09100 |
| PSA | 95.16000 |
| LogP | 1.87352 |
| Vapour Pressure | 6.52E-09mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | OUAQSPOCQDQFEV-UHFFFAOYSA-N |
| SMILES | CCCC1(C)C(C#N)(C#N)C1(C#N)C#N |
| HS Code | 2926909090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,1,2,2-tetracyano-3-methyl-3-propylcyclopropane |
| 3-Methyl-3-propyl-1,1,2,2-tetracyan-cyclopropan |