Way100135
Modify Date: 2025-09-13 11:27:12
Way100135 structure
|
Common Name | Way100135 | ||
|---|---|---|---|---|
| CAS Number | 133025-23-7 | Molecular Weight | 468.46000 | |
| Density | 1.085g/cm3 | Boiling Point | 582.8ºC at 760mmHg | |
| Molecular Formula | C24H35Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.3ºC | |
Use of Way100135Way 100135 is a serotonergic drug of the phenylpiperazine family which is used in scientific research. It acts as potent 5-HT1A receptor antagonist, and was originally believed to be highly selective, but further studies have demonstrated that it also acts as a partial agonist of the 5-HT1D receptor (pKi = 7.58; virtually the same affinity for 5-HT1A), and to a much lesser extent, of the 5-HT1B receptor (pKi = 5.82). These findings may have prompted the development of the related compound WAY-100,635, another purportedly selective and even more potent 5-HT1A antagonist, which was synthesized shortly thereafter. |
| Name | N-tert-butyl-3-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenylpropanamide |
|---|
| Density | 1.085g/cm3 |
|---|---|
| Boiling Point | 582.8ºC at 760mmHg |
| Molecular Formula | C24H35Cl2N3O2 |
| Molecular Weight | 468.46000 |
| Flash Point | 306.3ºC |
| Exact Mass | 467.21100 |
| PSA | 44.81000 |
| LogP | 5.51350 |
| Vapour Pressure | 1.43E-13mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | UMTDAKAAYOXIKU-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCN(CC(C(=O)NC(C)(C)C)c2ccccc2)CC1 |