Boc-trans-D-Hyp-OMe structure
|
Common Name | Boc-trans-D-Hyp-OMe | ||
|---|---|---|---|---|
| CAS Number | 135042-17-0 | Molecular Weight | 245.272 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 387.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2±27.9 °C | |
Use of Boc-trans-D-Hyp-OMeBoc-trans-D-Hyp-OMe is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Boc-trans-D-Hyp-OMe is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2]. |
| Name | (2R,4S)-1-tert-Butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-trans-D-Hyp-OMe is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Boc-trans-D-Hyp-OMe is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.6±42.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.272 |
| Flash Point | 188.2±27.9 °C |
| Exact Mass | 245.126328 |
| PSA | 76.07000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | MZMNEDXVUJLQAF-JGVFFNPUSA-N |
| SMILES | COC(=O)C1CC(O)CN1C(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| 1-O-tert-butyl 2-O-methyl (2R,4S)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| (4S)-4-Hydroxy-2-methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-proline |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-2-methyl-, 1-(1,1-dimethylethyl) ester, (2R,4S)- |