CRTh2 antagonist 1 structure
|
Common Name | CRTh2 antagonist 1 | ||
|---|---|---|---|---|
| CAS Number | 1379445-54-1 | Molecular Weight | 455.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CRTh2 antagonist 1CRTh2 antagonist 1 is a CRTh2 antagonist with an IC50 of 89 nM。 |
| Name | CRTh2 antagonist 1 |
|---|
| Description | CRTh2 antagonist 1 is a CRTh2 antagonist with an IC50 of 89 nM。 |
|---|---|
| Related Catalog | |
| Target |
IC50: 89 nM (CRTh2)[1] |
| In Vitro | CRTh2 antagonist 1 is compound 32[1]. |
| References |
| Molecular Formula | C23H25N3O5S |
|---|---|
| Molecular Weight | 455.53 |
| InChIKey | NAFLVUYNUAWSOI-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)c(-c2ccccc2)nn1Cc1ccccc1S(=O)(=O)N1CCOCC1 |