N-Boc-PEG5-alcohol structure
|
Common Name | N-Boc-PEG5-alcohol | ||
|---|---|---|---|---|
| CAS Number | 1404111-67-6 | Molecular Weight | 337.409 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 451.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H31NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8±27.3 °C | |
Use of N-Boc-PEG5-alcoholN-Boc-PEG5-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl (14-hydroxy-3,6,9,12-tetraoxatetradec-1-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-PEG5-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.5±40.0 °C at 760 mmHg |
| Molecular Formula | C15H31NO7 |
| Molecular Weight | 337.409 |
| Flash Point | 226.8±27.3 °C |
| Exact Mass | 337.210052 |
| LogP | -0.67 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | PBWLVPPLXJCLBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCO |
| Storage condition | -20°C |
| 2-Methyl-2-propanyl (14-hydroxy-3,6,9,12-tetraoxatetradec-1-yl)carbamate |
| Carbamic acid, N-(14-hydroxy-3,6,9,12-tetraoxatetradec-1-yl)-, 1,1-dimethylethyl ester |